3-methyl-5-nitrophenol, 98%
cas: 127818-58-0 — see every product listed under this CAS number, including other names
3-methyl-5-nitrophenol, 98% (CAS 127818-58-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat.
| brand | Combi-blocks |
|---|---|
| catalog number | AN-3398-1g |
| cas | 127818-58-0 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 100mg | price on request | |
| Fluorochem | 100mg | 143.72 Pln | |
| Fluorochem | 250mg | 206.20 Pln | |
| Fluorochem | 1g | 617.51 Pln | |
| Fluorochem | 5g | 1976.41 Pln | |
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 598.44 Pln | |
| Ambeed | 5g | 1922.31 Pln | |
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 376.40 Pln | |
| Chemat | 5g | 1264.40 Pln | |
| BLDpharm | 100mg | 153.30 Pln | |
| BLDpharm | 250mg | 219.95 Pln | |
| BLDpharm | 1g | 642.02 Pln | |
| BLDpharm | 5g | 2069.30 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
3-methyl-5-nitrophenol (CAS 127818-58-0) is a chemical compound with the molecular formula C7H7NO3 and a molecular weight of 153.14 g/mol. IUPAC name: 3-methyl-5-nitrophenol. InChIKey: KDKCEPVMXOUFJD-UHFFFAOYSA-N.
| Molecular formula | C7H7NO3 |
|---|---|
| Molecular weight | 153.14 g/mol |
| IUPAC name | 3-methyl-5-nitrophenol |
| InChIKey | KDKCEPVMXOUFJD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)