CAS 127818-58-0 appears in our catalog under these names: 3-methyl-5-nitrophenol, 98%, 3-Methyl-5-nitrophenol 98%, 3-Methyl-5-Nitrophenol, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg.
3-methyl-5-nitrophenol (CAS 127818-58-0) is a chemical compound with the molecular formula C7H7NO3 and a molecular weight of 153.14 g/mol. IUPAC name: 3-methyl-5-nitrophenol. InChIKey: KDKCEPVMXOUFJD-UHFFFAOYSA-N.
| Molecular formula | C7H7NO3 |
|---|---|
| Molecular weight | 153.14 g/mol |
| IUPAC name | 3-methyl-5-nitrophenol |
| InChIKey | KDKCEPVMXOUFJD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)