Products 1199-20-8
CAS 1199-20-8 appears in our catalog under these names: 3-phenylbut-2-enoic acid (E/Z mixture), 98%, 3-Phenylbut-2-enoic acid, 3-Phenylbut-2-enoic acid, 98%, 98%, 3-PHENYLBUT-2-ENOIC ACID, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 2,5g, 100mg, 250mg.
(E)-3-phenylbut-2-enoic acid (CAS 1199-20-8) is a chemical compound with the molecular formula C10H10O2 and a molecular weight of 162.18 g/mol. IUPAC name: (E)-3-phenylbut-2-enoic acid. InChIKey: PEXWJYDPDXUVSV-BQYQJAHWSA-N.
| Molecular formula | C10H10O2 |
|---|---|
| Molecular weight | 162.18 g/mol |
| IUPAC name | (E)-3-phenylbut-2-enoic acid |
| InChIKey | PEXWJYDPDXUVSV-BQYQJAHWSA-N |
| SMILES | C/C(=C\C(=O)O)/C1=CC=CC=C1 |
Computed by PubChem (NCBI)