cas: 126208-61-5 — see every product listed under this CAS number, including other names
3-tert-Butyl-1-phenyl-1H-pyrazol-5-amine, 95% (CAS 126208-61-5) is a chemical reagent available from Chemat. Available pack sizes: 100g, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F021512-100G |
| cas | 126208-61-5 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100g | 1825.42 Pln | |
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 195.78 Pln | |
| Fluorochem | 25g | 653.95 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3-tert-butyl-1-phenylpyrazol-5-amine (CAS 126208-61-5) is a chemical compound with the molecular formula C13H17N3 and a molecular weight of 215.29 g/mol. IUPAC name: 3-tert-butyl-1-phenylpyrazol-5-amine. InChIKey: GFWSTBBSSBVVQP-UHFFFAOYSA-N.
| Molecular formula | C13H17N3 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | 3-tert-butyl-1-phenylpyrazol-5-amine |
| InChIKey | GFWSTBBSSBVVQP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NN(C(=C1)N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)