cas: 126208-61-5 — see every product listed under this CAS number, including other names
5-tert-Butyl-2-phenyl-2H-pyrazol-3-ylamin, 98%, 98% (CAS 126208-61-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111SD4-1g |
| cas | 126208-61-5 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 155.60 Pln | |
| Chemat | 25g | 467.60 Pln | |
| Chemat | 100g | 1360.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-tert-butyl-1-phenylpyrazol-5-amine (CAS 126208-61-5) is a chemical compound with the molecular formula C13H17N3 and a molecular weight of 215.29 g/mol. IUPAC name: 3-tert-butyl-1-phenylpyrazol-5-amine. InChIKey: GFWSTBBSSBVVQP-UHFFFAOYSA-N.
| Molecular formula | C13H17N3 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | 3-tert-butyl-1-phenylpyrazol-5-amine |
| InChIKey | GFWSTBBSSBVVQP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NN(C(=C1)N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)