cas: 64198-16-9 — see every product listed under this CAS number, including other names
3a,3b,6a,6b-Tetramethyltetrahydrocyclobuta[1,2-c:3,4-c']difuran-1,3,4,6-tetraone 98+% (CAS 64198-16-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A380495-250mg |
| cas | 64198-16-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 437.12 Pln | |
| Ambeed | 1g | 509.44 Pln | |
| Ambeed | 5g | 1532.94 Pln |
| purity | 98+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A380495 |
1,2,6,7-tetramethyl-4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone (CAS 64198-16-9) is a chemical compound with the molecular formula C12H12O6 and a molecular weight of 252.22 g/mol. IUPAC name: 1,2,6,7-tetramethyl-4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone. InChIKey: GTDPSWPPOUPBNX-UHFFFAOYSA-N.
| Molecular formula | C12H12O6 |
|---|---|
| Molecular weight | 252.22 g/mol |
| IUPAC name | 1,2,6,7-tetramethyl-4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone |
| InChIKey | GTDPSWPPOUPBNX-UHFFFAOYSA-N |
| SMILES | CC12C(=O)OC(=O)C1(C3(C2(C(=O)OC3=O)C)C)C |
Computed by PubChem (NCBI)