Products 613-03-6
CAS 613-03-6 appears in our catalog under these names: 1,2,4-Triacetoxybenzene, 95%, 1,2,4-Triacetoxybenzene, 1,2,4–Triacetoxybenzene, 1,2,4-Triacetoxybenzene, >95.0%(GC), 1,2,4-TRIACETOXYBENZENE, 97%. Offered by: Combi-blocks, TRC, GLPBio, TCI, Sigma-Aldrich. Available pack sizes: 1g, 100g, 25g, 5g, 10g, 500g.
(3,4-diacetyloxyphenyl) acetate (CAS 613-03-6) is a chemical compound with the molecular formula C12H12O6 and a molecular weight of 252.22 g/mol. IUPAC name: (3,4-diacetyloxyphenyl) acetate. InChIKey: AESFGSJWSUZRGW-UHFFFAOYSA-N.
| Molecular formula | C12H12O6 |
|---|---|
| Molecular weight | 252.22 g/mol |
| IUPAC name | (3,4-diacetyloxyphenyl) acetate |
| InChIKey | AESFGSJWSUZRGW-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC(=C(C=C1)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)
Synonyms:
1,2,4-Triacetoxybenzene, 1,2,4-Benzenetriacetate, Pyrogallol A, 1,2,4-Benzenetriol triacetate, 1,2,4-Tri-acetoxybenzene, 4-06-00-07342 (Beilstein Handbook Reference), AESFGSJWSUZRGW-UHFFFAOYSA-N, Benzene-1,2,4-triyl triacetate, Hydroxyhydroquinone triacetate, 2-Hydroxyhydroquinone triacetate