Products 71932-29-1
CAS 71932-29-1 appears in our catalog under these names: 4-Acetoxyisophthalic acid dimethyl ester, 95%, Dimethyl 4–Acetoxyisophthalate, Dimethyl 4-Acetoxyisophthalate, >98.0%(GC), 4-Acetoxyisophthalic acid dimethyl ester, 98.0%, 98.0%, Dimethyl 4-acetoxyisophthalate, 97%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 200mg.
Dimethyl 4-acetyloxybenzene-1,3-dicarboxylate (CAS 71932-29-1) is a chemical compound with the molecular formula C12H12O6 and a molecular weight of 252.22 g/mol. IUPAC name: dimethyl 4-acetyloxybenzene-1,3-dicarboxylate. InChIKey: MZBAKPXGINZGLK-UHFFFAOYSA-N.
| Molecular formula | C12H12O6 |
|---|---|
| Molecular weight | 252.22 g/mol |
| IUPAC name | dimethyl 4-acetyloxybenzene-1,3-dicarboxylate |
| InChIKey | MZBAKPXGINZGLK-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=C(C=C1)C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)