CAS 54296-25-2 appears in our catalog under these names: 4-Cyano-4'-n-propyl-p-terphenyl, 95%, 4''–Propyl–(1,1':4',1''–terphenyl)–4–carbonitrile, 4-Cyano-4''-propyl-p-terphenyl, >98.0%(GC), 4-Cyano-4'-n-propyl-p-terphenyl, 98%, 98%, 4''-Propyl-[1,1':4',1''-terphenyl]-4-carbonitrile, 98%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
4-[4-(4-propylphenyl)phenyl]benzonitrile (CAS 54296-25-2) is a chemical compound with the molecular formula C22H19N and a molecular weight of 297.4 g/mol. IUPAC name: 4-[4-(4-propylphenyl)phenyl]benzonitrile. InChIKey: PWZKBBQJWUEPOK-UHFFFAOYSA-N.
| Molecular formula | C22H19N |
|---|---|
| Molecular weight | 297.4 g/mol |
| IUPAC name | 4-[4-(4-propylphenyl)phenyl]benzonitrile |
| InChIKey | PWZKBBQJWUEPOK-UHFFFAOYSA-N |
| SMILES | CCCC1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=C(C=C3)C#N |
Computed by PubChem (NCBI)