CAS 3333-16-2 is the registry number for 2-Benzyl-2,3-diphenylpropanenitrile, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
2-benzyl-2,3-diphenylpropanenitrile (CAS 3333-16-2) is a chemical compound with the molecular formula C22H19N and a molecular weight of 297.4 g/mol. IUPAC name: 2-benzyl-2,3-diphenylpropanenitrile. InChIKey: QLGWFVNKFGJFPA-UHFFFAOYSA-N.
| Molecular formula | C22H19N |
|---|---|
| Molecular weight | 297.4 g/mol |
| IUPAC name | 2-benzyl-2,3-diphenylpropanenitrile |
| InChIKey | QLGWFVNKFGJFPA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(CC2=CC=CC=C2)(C#N)C3=CC=CC=C3 |
Computed by PubChem (NCBI)