CAS 1384966-38-4 is the registry number for 1-(2,6-Dimethyl-phenyl)-2-phenyl-1H-indole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
1-(2,6-dimethylphenyl)-2-phenylindole (CAS 1384966-38-4) is a chemical compound with the molecular formula C22H19N and a molecular weight of 297.4 g/mol. IUPAC name: 1-(2,6-dimethylphenyl)-2-phenylindole. InChIKey: MWAQNELMMZYWFO-UHFFFAOYSA-N.
| Molecular formula | C22H19N |
|---|---|
| Molecular weight | 297.4 g/mol |
| IUPAC name | 1-(2,6-dimethylphenyl)-2-phenylindole |
| InChIKey | MWAQNELMMZYWFO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)N2C3=CC=CC=C3C=C2C4=CC=CC=C4 |
Computed by PubChem (NCBI)