cas: 30314-44-4 — see every product listed under this CAS number, including other names
4',2,2–Trimethylpropiophenone (CAS 30314-44-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF27880-100mg |
| cas | 30314-44-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 512.79 Pln | |
| GLPBio | 1g | 788.94 Pln | |
| GLPBio | 250mg | 564.28 Pln | |
| GLPBio | 5g | 1612.71 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
2,2-dimethyl-1-(4-methylphenyl)propan-1-one (CAS 30314-44-4) is a chemical compound with the molecular formula C12H16O and a molecular weight of 176.25 g/mol. IUPAC name: 2,2-dimethyl-1-(4-methylphenyl)propan-1-one. InChIKey: ZYWGAHRBGCEFAO-UHFFFAOYSA-N.
| Molecular formula | C12H16O |
|---|---|
| Molecular weight | 176.25 g/mol |
| IUPAC name | 2,2-dimethyl-1-(4-methylphenyl)propan-1-one |
| InChIKey | ZYWGAHRBGCEFAO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C(C)(C)C |
Computed by PubChem (NCBI)