cas: 72293-96-0 — see every product listed under this CAS number, including other names
4'-(4-Fluorobenzyloxy)acetophenone (CAS 72293-96-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F008324-1G |
| cas | 72293-96-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 164.54 Pln | |
| Fluorochem | 5g | 424.87 Pln | |
| Fluorochem | 10g | 638.33 Pln | |
| Fluorochem | 25g | 1455.76 Pln |
| delivery time | 2-3 weeks |
|---|
1-[4-[(4-fluorophenyl)methoxy]phenyl]ethanone (CAS 72293-96-0) is a chemical compound with the molecular formula C15H13FO2 and a molecular weight of 244.26 g/mol. IUPAC name: 1-[4-[(4-fluorophenyl)methoxy]phenyl]ethanone. InChIKey: MQJDMMIBGFVIDR-UHFFFAOYSA-N.
| Molecular formula | C15H13FO2 |
|---|---|
| Molecular weight | 244.26 g/mol |
| IUPAC name | 1-[4-[(4-fluorophenyl)methoxy]phenyl]ethanone |
| InChIKey | MQJDMMIBGFVIDR-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)OCC2=CC=C(C=C2)F |
Computed by PubChem (NCBI)