cas: 37075-25-5 — see every product listed under this CAS number, including other names
4'-(Amyloxy)benzylidene-4-cyanoaniline (CAS 37075-25-5) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114K6W-200mg |
| cas | 37075-25-5 |
| size | 200mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 200mg | 227.60 Pln | |
| Chemat | 1g | 822.80 Pln | |
| Chemat | 5g | 3347.60 Pln |
| delivery time | 3 weeks |
|---|
4-[(4-pentoxyphenyl)methylideneamino]benzonitrile (CAS 37075-25-5) is a chemical compound with the molecular formula C19H20N2O and a molecular weight of 292.4 g/mol. IUPAC name: 4-[(4-pentoxyphenyl)methylideneamino]benzonitrile. InChIKey: IUWUDHSOMQRZCV-UHFFFAOYSA-N.
| Molecular formula | C19H20N2O |
|---|---|
| Molecular weight | 292.4 g/mol |
| IUPAC name | 4-[(4-pentoxyphenyl)methylideneamino]benzonitrile |
| InChIKey | IUWUDHSOMQRZCV-UHFFFAOYSA-N |
| SMILES | CCCCCOC1=CC=C(C=C1)C=NC2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)