CAS 19732-57-1 is the registry number for 2,7,7-Trimethyl-5-oxo-4-phenyl-1,4,5,6,7,8-hexahydro-3-quinolinecarbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2,7,7-trimethyl-5-oxo-4-phenyl-1,4,6,8-tetrahydroquinoline-3-carbonitrile (CAS 19732-57-1) is a chemical compound with the molecular formula C19H20N2O and a molecular weight of 292.4 g/mol. IUPAC name: 2,7,7-trimethyl-5-oxo-4-phenyl-1,4,6,8-tetrahydroquinoline-3-carbonitrile. InChIKey: VLEZVELXWQAPHS-UHFFFAOYSA-N.
| Molecular formula | C19H20N2O |
|---|---|
| Molecular weight | 292.4 g/mol |
| IUPAC name | 2,7,7-trimethyl-5-oxo-4-phenyl-1,4,6,8-tetrahydroquinoline-3-carbonitrile |
| InChIKey | VLEZVELXWQAPHS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(C2=C(N1)CC(CC2=O)(C)C)C3=CC=CC=C3)C#N |
Computed by PubChem (NCBI)