Products 1820747-29-2

CAS 1820747-29-2 is the registry number for 1,3-Bis(1-Phenylcyclopropyl)urea, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

1,3-bis(1-phenylcyclopropyl)urea (CAS 1820747-29-2) is a chemical compound with the molecular formula C19H20N2O and a molecular weight of 292.4 g/mol. IUPAC name: 1,3-bis(1-phenylcyclopropyl)urea. InChIKey: WKKWFHIIDRJSNC-UHFFFAOYSA-N.

Identity
Molecular formulaC19H20N2O
Molecular weight292.4 g/mol
IUPAC name1,3-bis(1-phenylcyclopropyl)urea
InChIKeyWKKWFHIIDRJSNC-UHFFFAOYSA-N
SMILESC1CC1(C2=CC=CC=C2)NC(=O)NC3(CC3)C4=CC=CC=C4

Computed by PubChem (NCBI)