cas: 173025-79-1 — see every product listed under this CAS number, including other names
4'-(Trifluoromethoxy)-[1,1'-biphenyl]-4-ol 98% (CAS 173025-79-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A626528-250mg |
| cas | 173025-79-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 492.75 Pln | |
| Ambeed | 5g | 1644.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A626528 |
4-[4-(trifluoromethoxy)phenyl]phenol (CAS 173025-79-1) is a chemical compound with the molecular formula C13H9F3O2 and a molecular weight of 254.20 g/mol. IUPAC name: 4-[4-(trifluoromethoxy)phenyl]phenol. InChIKey: BQHPTVCTYWEKJL-UHFFFAOYSA-N.
| Molecular formula | C13H9F3O2 |
|---|---|
| Molecular weight | 254.20 g/mol |
| IUPAC name | 4-[4-(trifluoromethoxy)phenyl]phenol |
| InChIKey | BQHPTVCTYWEKJL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)OC(F)(F)F)O |
Computed by PubChem (NCBI)