cas: 400747-98-0 — see every product listed under this CAS number, including other names
4'-(Trifluoromethyl)-[1,1'-biphenyl]-3-amine 97% (CAS 400747-98-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A352969-100mg |
| cas | 400747-98-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 437.12 Pln | |
| Ambeed | 250mg | 509.44 Pln | |
| Ambeed | 1g | 1010.06 Pln | |
| Ambeed | 5g | 3474.25 Pln | |
| Ambeed | 10g | 5020.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A352969 |
3-[4-(trifluoromethyl)phenyl]aniline (CAS 400747-98-0) is a chemical compound with the molecular formula C13H10F3N and a molecular weight of 237.22 g/mol. IUPAC name: 3-[4-(trifluoromethyl)phenyl]aniline. InChIKey: RTSCKIULIJLTHO-UHFFFAOYSA-N.
| Molecular formula | C13H10F3N |
|---|---|
| Molecular weight | 237.22 g/mol |
| IUPAC name | 3-[4-(trifluoromethyl)phenyl]aniline |
| InChIKey | RTSCKIULIJLTHO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)