CAS 400747-98-0 appears in our catalog under these names: 3-[4-(Trifluoromethyl)phenyl]aniline, 95%, 3-Amino-4‚Ä≤-(trifluoromethyl)-1,1‚Ä≤-biphenyl, 95-<97%, 3-Amino-4‚Ä≤-(trifluoromethyl)-1,1‚Ä≤-biphenyl, ≥97-<99%, 4'-(Trifluoromethyl)-[1,1'-biphenyl]-3-amine 97%. Offered by: Combi-blocks, Hoffman Fine Chemicals, Ambeed. Available pack sizes: 5g, 10g, 250mg, 1g, 2,5g, 25g, 100mg.
3-[4-(trifluoromethyl)phenyl]aniline (CAS 400747-98-0) is a chemical compound with the molecular formula C13H10F3N and a molecular weight of 237.22 g/mol. IUPAC name: 3-[4-(trifluoromethyl)phenyl]aniline. InChIKey: RTSCKIULIJLTHO-UHFFFAOYSA-N.
| Molecular formula | C13H10F3N |
|---|---|
| Molecular weight | 237.22 g/mol |
| IUPAC name | 3-[4-(trifluoromethyl)phenyl]aniline |
| InChIKey | RTSCKIULIJLTHO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)