cas: 400747-98-0 — see every product listed under this CAS number, including other names
3-Amino-4′-(trifluoromethyl)-1,1′-biphenyl, 95-<97% (CAS 400747-98-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC3516-95-97-1g |
| cas | 400747-98-0 |
| size | 1g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 1g | 3108.82 Pln | |
| Hoffman Fine Chemicals | 2,5g | 5073.86 Pln | |
| Hoffman Fine Chemicals | 5g | 7562.06 Pln | |
| Hoffman Fine Chemicals | 10g | 11919.60 Pln | |
| Hoffman Fine Chemicals | 25g | 23531.20 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
3-[4-(trifluoromethyl)phenyl]aniline (CAS 400747-98-0) is a chemical compound with the molecular formula C13H10F3N and a molecular weight of 237.22 g/mol. IUPAC name: 3-[4-(trifluoromethyl)phenyl]aniline. InChIKey: RTSCKIULIJLTHO-UHFFFAOYSA-N.
| Molecular formula | C13H10F3N |
|---|---|
| Molecular weight | 237.22 g/mol |
| IUPAC name | 3-[4-(trifluoromethyl)phenyl]aniline |
| InChIKey | RTSCKIULIJLTHO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)