4'-Bromo-N,N-diphenyl-[1,1'-biphenyl]-4-amine, 97%
cas: 202831-65-0 — see every product listed under this CAS number, including other names
4'-Bromo-N,N-diphenyl-[1,1'-biphenyl]-4-amine, 97% (CAS 202831-65-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A188480-250mg |
| cas | 202831-65-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 309.19 Pln | |
| Ambeed | 10g | 520.56 Pln | |
| Ambeed | 25g | 993.38 Pln | |
| Ambeed | 100g | 3034.81 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 1g | 208.84 Pln | |
| BLDpharm | 5g | 325.47 Pln | |
| BLDpharm | 10g | 553.16 Pln | |
| BLDpharm | 25g | 1069.65 Pln | |
| BLDpharm | 100g | 3263.32 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
4-(4-bromophenyl)-N,N-diphenylaniline (CAS 202831-65-0) is a chemical compound with the molecular formula C24H18BrN and a molecular weight of 400.3 g/mol. IUPAC name: 4-(4-bromophenyl)-N,N-diphenylaniline. InChIKey: NKCKVJVKWGWKRK-UHFFFAOYSA-N.
| Molecular formula | C24H18BrN |
|---|---|
| Molecular weight | 400.3 g/mol |
| IUPAC name | 4-(4-bromophenyl)-N,N-diphenylaniline |
| InChIKey | NKCKVJVKWGWKRK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)C4=CC=C(C=C4)Br |
Computed by PubChem (NCBI)
Synonyms:
4-Bromo-4'-(diphenylamino)biphenyl, 4'-Bromo-N,N-diphenyl-[1,1'-biphenyl]-4-amine, 4-(4-bromophenyl)-N,N-diphenylaniline, [1,1'-Biphenyl]-4-amine, 4'-bromo-N,N-diphenyl-, C24H18BrN, 4'-bromo-N,N-diphenyl-1,1'-biphenyl-4-amine, (4'-Bromobiphenyl-4-yl)diphenylamine, 4-(N,N-diphenylamino)-4'-bromobiphenyl, 4-bromo-4'-(N,N-diphenylamino)biphenyl, 4-(4-bromophenyl)-N,N-diphenyl-aniline