Products 1967833-41-5

CAS 1967833-41-5 is the registry number for N-(6-Bromo[1,1′-biphenyl]-3-yl)[1,1′-biphenyl]-4-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

4-bromo-3-phenyl-N-(4-phenylphenyl)aniline (CAS 1967833-41-5) is a chemical compound with the molecular formula C24H18BrN and a molecular weight of 400.3 g/mol. IUPAC name: 4-bromo-3-phenyl-N-(4-phenylphenyl)aniline. InChIKey: NNOBOTPMTMLMPC-UHFFFAOYSA-N.

Identity
Molecular formulaC24H18BrN
Molecular weight400.3 g/mol
IUPAC name4-bromo-3-phenyl-N-(4-phenylphenyl)aniline
InChIKeyNNOBOTPMTMLMPC-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=CC=C(C=C2)NC3=CC(=C(C=C3)Br)C4=CC=CC=C4

Computed by PubChem (NCBI)