CAS 503299-24-9 appears in our catalog under these names: N-(4-Bromophenyl)-N,4-diphenylaniline, 95%, N–(4–Bromophenyl)–N–phenyl(1,1′–biphenyl)–4–amine, 4-Bromo-4'-phenyltriphenylamine, >98.0%(GC), 4-Bromo-4'-phenyltriphenylamine, 99%, 99%, N-(4-BROMOPHENYL)-N-PHENYL-[1,1'-BIPHENYL]-4-AMINE. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g.
N-(4-bromophenyl)-N,4-diphenylaniline (CAS 503299-24-9) is a chemical compound with the molecular formula C24H18BrN and a molecular weight of 400.3 g/mol. IUPAC name: N-(4-bromophenyl)-N,4-diphenylaniline. InChIKey: AFDFEVPHXYRVDH-UHFFFAOYSA-N.
| Molecular formula | C24H18BrN |
|---|---|
| Molecular weight | 400.3 g/mol |
| IUPAC name | N-(4-bromophenyl)-N,4-diphenylaniline |
| InChIKey | AFDFEVPHXYRVDH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)N(C3=CC=CC=C3)C4=CC=C(C=C4)Br |
Computed by PubChem (NCBI)