cas: 13610-11-2 — see every product listed under this CAS number, including other names
4'-Bromobiphenyl-4-sulfonyl chloride, 97% (CAS 13610-11-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F014903-50MG |
| cas | 13610-11-2 |
| size | 50mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 247.85 Pln | |
| Fluorochem | 100mg | 357.18 Pln | |
| Fluorochem | 250mg | 555.03 Pln | |
| Fluorochem | 500mg | 857.01 Pln | |
| Fluorochem | 1g | 1486.99 Pln | |
| Fluorochem | 2.5g | 2991.67 Pln | |
| Fluorochem | 5g | 5043.03 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
4-(4-bromophenyl)benzenesulfonyl chloride (CAS 13610-11-2) is a chemical compound with the molecular formula C12H8BrClO2S and a molecular weight of 331.61 g/mol. IUPAC name: 4-(4-bromophenyl)benzenesulfonyl chloride. InChIKey: SSBVDUAYXSMLTR-UHFFFAOYSA-N.
| Molecular formula | C12H8BrClO2S |
|---|---|
| Molecular weight | 331.61 g/mol |
| IUPAC name | 4-(4-bromophenyl)benzenesulfonyl chloride |
| InChIKey | SSBVDUAYXSMLTR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)