Products 13610-11-2
CAS 13610-11-2 appears in our catalog under these names: 4'-Bromo-[1,1'-biphenyl]-4-sulfonyl chloride, 95%, 95%, 4'-Bromobiphenyl-4-sulfonyl chloride, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 50mg, 500mg, 2.5g.
4-(4-bromophenyl)benzenesulfonyl chloride (CAS 13610-11-2) is a chemical compound with the molecular formula C12H8BrClO2S and a molecular weight of 331.61 g/mol. IUPAC name: 4-(4-bromophenyl)benzenesulfonyl chloride. InChIKey: SSBVDUAYXSMLTR-UHFFFAOYSA-N.
| Molecular formula | C12H8BrClO2S |
|---|---|
| Molecular weight | 331.61 g/mol |
| IUPAC name | 4-(4-bromophenyl)benzenesulfonyl chloride |
| InChIKey | SSBVDUAYXSMLTR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
4'-Bromobiphenyl-4-sulfonyl chloride, 4'-Bromo-[1,1'-biphenyl]-4-sulfonyl chloride, 4-(4-bromophenyl)benzene-1-sulfonyl chloride, 4-(4-bromophenyl)benzenesulfonyl Chloride, 4/'-Bromobiphenyl-4-sulfonyl chloride, 4'-bromo-biphenyl-4-sulfonyl chloride, 4'-Bromo-[1,1'-biphenyl]-4-sulfonylchloride, SSBVDUAYXSMLTR-UHFFFAOYSA-N, 4'-bromo-4-biphenylylsulphonyl chloride, 4'-Bromo[1,1'-biphenyl]-4-sulfonyl chloride