CAS 65082-45-3 appears in our catalog under these names: 1-Bromo-4-((4-chlorophenyl)sulfonyl)benzene, 95%, 1-BROMO-4-((4-CHLOROPHENYL)SULFONYL)BENZENE, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg.
1-(4-bromophenyl)sulfonyl-4-chlorobenzene (CAS 65082-45-3) is a chemical compound with the molecular formula C12H8BrClO2S and a molecular weight of 331.61 g/mol. IUPAC name: 1-(4-bromophenyl)sulfonyl-4-chlorobenzene. InChIKey: UGMPHUWLSLSAHB-UHFFFAOYSA-N.
| Molecular formula | C12H8BrClO2S |
|---|---|
| Molecular weight | 331.61 g/mol |
| IUPAC name | 1-(4-bromophenyl)sulfonyl-4-chlorobenzene |
| InChIKey | UGMPHUWLSLSAHB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)C2=CC=C(C=C2)Br)Cl |
Computed by PubChem (NCBI)