cas: 18594-05-3 — see every product listed under this CAS number, including other names
4'-Cyclohexylacetophenone 98% (CAS 18594-05-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A245381-5g |
| cas | 18594-05-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 270.25 Pln | |
| Ambeed | 10g | 464.94 Pln | |
| Ambeed | 25g | 854.31 Pln | |
| Ambeed | 100g | 2428.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A245381 |
1-(4-cyclohexylphenyl)ethanone (CAS 18594-05-3) is a chemical compound with the molecular formula C14H18O and a molecular weight of 202.29 g/mol. IUPAC name: 1-(4-cyclohexylphenyl)ethanone. InChIKey: MSDQNIRGPBARGC-UHFFFAOYSA-N.
| Molecular formula | C14H18O |
|---|---|
| Molecular weight | 202.29 g/mol |
| IUPAC name | 1-(4-cyclohexylphenyl)ethanone |
| InChIKey | MSDQNIRGPBARGC-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)C2CCCCC2 |
Computed by PubChem (NCBI)