cas: 18594-05-3 — see every product listed under this CAS number, including other names
4'-Cyclohexylacetophenone, 98%, 98% (CAS 18594-05-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 15g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114KLO-1g |
| cas | 18594-05-3 |
| size | 1g |
| availability | 242g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 117.20 Pln | |
| Chemat | 10g | 150.80 Pln | |
| Chemat | 15g | 189.20 Pln | |
| Chemat | 25g | 256.40 Pln | |
| Chemat | 100g | 702.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-(4-cyclohexylphenyl)ethanone (CAS 18594-05-3) is a chemical compound with the molecular formula C14H18O and a molecular weight of 202.29 g/mol. IUPAC name: 1-(4-cyclohexylphenyl)ethanone. InChIKey: MSDQNIRGPBARGC-UHFFFAOYSA-N.
| Molecular formula | C14H18O |
|---|---|
| Molecular weight | 202.29 g/mol |
| IUPAC name | 1-(4-cyclohexylphenyl)ethanone |
| InChIKey | MSDQNIRGPBARGC-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)C2CCCCC2 |
Computed by PubChem (NCBI)