4'-Ethynyl-2-methyl-1,1'-biphenyl, 95+%
cas: 56957-89-2 — see every product listed under this CAS number, including other names
4'-Ethynyl-2-methyl-1,1'-biphenyl, 95+% (CAS 56957-89-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A167629-250mg |
| cas | 56957-89-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 804.25 Pln | |
| Ambeed | 1g | 2061.38 Pln | |
| Ambeed | 5g | 8035.50 Pln | |
| Chemat | 100mg | 506.00 Pln | |
| Chemat | 250mg | 813.20 Pln | |
| Chemat | 1g | 2090.00 Pln | |
| BLDpharm | 100mg | 536.50 Pln | |
| BLDpharm | 250mg | 864.16 Pln | |
| BLDpharm | 1g | 2213.69 Pln | |
| BLDpharm | 5g | 8655.87 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
1-ethynyl-4-(2-methylphenyl)benzene (CAS 56957-89-2) is a chemical compound with the molecular formula C15H12 and a molecular weight of 192.25 g/mol. IUPAC name: 1-ethynyl-4-(2-methylphenyl)benzene. InChIKey: VEWQNKABGVYDAZ-UHFFFAOYSA-N.
| Molecular formula | C15H12 |
|---|---|
| Molecular weight | 192.25 g/mol |
| IUPAC name | 1-ethynyl-4-(2-methylphenyl)benzene |
| InChIKey | VEWQNKABGVYDAZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2=CC=C(C=C2)C#C |
Computed by PubChem (NCBI)