CAS 832-71-3 appears in our catalog under these names: 3-Methylphenanthrene, 3–Methylphenanthrene, 3-Methylphenanthrene, 95%, 3-Methylphenanthrene, >=98%, 3-Methylphenanthrene, >98.0%(GC). Offered by: TRC, Dr. Ehrenstorfer, GLPBio, Biosynth, Combi-blocks. Available pack sizes: 500mg, 10mg, 25mg, 50mg, 100mg.
3-methylphenanthrene (CAS 832-71-3) is a chemical compound with the molecular formula C15H12 and a molecular weight of 192.25 g/mol. IUPAC name: 3-methylphenanthrene. InChIKey: GKYWZUBZZBHZKU-UHFFFAOYSA-N.
| Molecular formula | C15H12 |
|---|---|
| Molecular weight | 192.25 g/mol |
| IUPAC name | 3-methylphenanthrene |
| InChIKey | GKYWZUBZZBHZKU-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C=CC3=CC=CC=C32 |
Computed by PubChem (NCBI)