Products 6406-97-9
CAS 6406-97-9 appears in our catalog under these names: 9-Methylanthracene-d12, 9-Methylanthracene-d12, >95% (HPLC), 9-Methylanthracene-d12, 98 atom % D, min 98% Chemical Purity. Offered by: MedChemExpress, TRC, CDN. Available pack sizes: 10 mg, 2 mg, 1 mg, 10mg, 1mg, 2mg, 0,1g, 0,05g.
1,2,3,4,5,6,7,8,9-nonadeuterio-10-(trideuteriomethyl)anthracene (CAS 6406-97-9) is a chemical compound with the molecular formula C15H12 and a molecular weight of 204.33 g/mol. IUPAC name: 1,2,3,4,5,6,7,8,9-nonadeuterio-10-(trideuteriomethyl)anthracene. InChIKey: CPGPAVAKSZHMBP-VVAQFOCRSA-N.
| Molecular formula | C15H12 |
|---|---|
| Molecular weight | 204.33 g/mol |
| IUPAC name | 1,2,3,4,5,6,7,8,9-nonadeuterio-10-(trideuteriomethyl)anthracene |
| InChIKey | CPGPAVAKSZHMBP-VVAQFOCRSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C3C(=C(C(=C(C3=C2C([2H])([2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)