4'-Fluoro-[1,1'-biphenyl]-4-ol, 98%
cas: 324-94-7 — see every product listed under this CAS number, including other names
4'-Fluoro-[1,1'-biphenyl]-4-ol, 98% (CAS 324-94-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g, 50g. Offered by: Ambeed, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A300367-250mg |
| cas | 324-94-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 225.75 Pln | |
| Ambeed | 10g | 253.56 Pln | |
| Ambeed | 25g | 337.00 Pln | |
| Ambeed | 100g | 676.31 Pln | |
| Ambeed | 500g | 2506.38 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 10g | 117.20 Pln | |
| Chemat | 25g | 194.00 Pln | |
| Chemat | 50g | 318.80 Pln | |
| Chemat | 100g | 544.40 Pln | |
| Chemat | 250g | 1197.20 Pln | |
| Chemat | 500g | 2337.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
4-(4-fluorophenyl)phenol (CAS 324-94-7) is a chemical compound with the molecular formula C12H9FO and a molecular weight of 188.20 g/mol. IUPAC name: 4-(4-fluorophenyl)phenol. InChIKey: QSJNKJGPJVOGPK-UHFFFAOYSA-N.
| Molecular formula | C12H9FO |
|---|---|
| Molecular weight | 188.20 g/mol |
| IUPAC name | 4-(4-fluorophenyl)phenol |
| InChIKey | QSJNKJGPJVOGPK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)F)O |
Computed by PubChem (NCBI)
Synonyms:
4-Fluoro-4'-hydroxybiphenyl, 4'-Fluoro-[1,1'-biphenyl]-4-ol, 4-(4-Fluorophenyl)phenol, 4-Hydroxy-4'-fluorobiphenyl, 4'-Fluoro-biphenyl-4-ol, 4'-fluoro[1,1'-biphenyl]-4-ol, 4'-Fluorobiphenyl-1-ol, 4'-Fluoro-[1,1'-biphenyl]-4-ol;4-Fluoro-4'-hydroxybiphenyl, 4'-fluorobiphenyl-4-ol, 4'-fluoro-4-hydroxybiphenyl