cas: 29558-78-9 — see every product listed under this CAS number, including other names
4'-Iodo-1,1'-biphenyl-4-ol, 98%, 98% (CAS 29558-78-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113YRA-1g |
| cas | 29558-78-9 |
| size | 1g |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 237.20 Pln | |
| Chemat | 5g | 678.80 Pln | |
| Chemat | 25g | 2402.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-(4-iodophenyl)phenol (CAS 29558-78-9) is a chemical compound with the molecular formula C12H9IO and a molecular weight of 296.10 g/mol. IUPAC name: 4-(4-iodophenyl)phenol. InChIKey: WJXIAMCDWSUSEI-UHFFFAOYSA-N.
| Molecular formula | C12H9IO |
|---|---|
| Molecular weight | 296.10 g/mol |
| IUPAC name | 4-(4-iodophenyl)phenol |
| InChIKey | WJXIAMCDWSUSEI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)I)O |
Computed by PubChem (NCBI)