CAS 87441-19-8 appears in our catalog under these names: 5-Iodo-[1,1'-biphenyl]-2-ol, 95%, 5–Iodo–(1,1'–biphenyl)–2–ol, 4-Iodo-2-phenylphenol. Offered by: Combi-blocks, GLPBio, Biosynth, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 0,5g.
4-iodo-2-phenylphenol (CAS 87441-19-8) is a chemical compound with the molecular formula C12H9IO and a molecular weight of 296.10 g/mol. IUPAC name: 4-iodo-2-phenylphenol. InChIKey: RNAKFENSCBCFIJ-UHFFFAOYSA-N.
| Molecular formula | C12H9IO |
|---|---|
| Molecular weight | 296.10 g/mol |
| IUPAC name | 4-iodo-2-phenylphenol |
| InChIKey | RNAKFENSCBCFIJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=CC(=C2)I)O |
Computed by PubChem (NCBI)