CAS 29558-78-9 appears in our catalog under these names: 4-Hydroxy-4'-iodobiphenyl, 98%, 4-Hydroxy-4’-iodobiphenyl, 4–Hydroxy–4′–iodobiphenyl, 4-(4'-Iodophenyl)phenol, 4'-Iodo-1,1'-biphenyl-4-ol, 98%, 98%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: 25g, 5g, 1g, 750mg, 2g, 10g, 50g.
4-(4-iodophenyl)phenol (CAS 29558-78-9) is a chemical compound with the molecular formula C12H9IO and a molecular weight of 296.10 g/mol. IUPAC name: 4-(4-iodophenyl)phenol. InChIKey: WJXIAMCDWSUSEI-UHFFFAOYSA-N.
| Molecular formula | C12H9IO |
|---|---|
| Molecular weight | 296.10 g/mol |
| IUPAC name | 4-(4-iodophenyl)phenol |
| InChIKey | WJXIAMCDWSUSEI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)I)O |
Computed by PubChem (NCBI)