cas: 38861-78-8 — see every product listed under this CAS number, including other names
4'-Isobutylacetophenone, >96.0%(GC) (CAS 38861-78-8) is a chemical reagent available from Chemat. Available pack sizes: 25ml, 100ml, 500ml. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | I0417-25ML |
| cas | 38861-78-8 |
| size | 25ml |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25ml | 187.19 Pln | |
| TCI | 100ml | 501.89 Pln | |
| TCI | 500ml | 2104.91 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >96.0%(GC) |
1-[4-(2-methylpropyl)phenyl]ethanone (CAS 38861-78-8) is a chemical compound with the molecular formula C12H16O and a molecular weight of 176.25 g/mol. IUPAC name: 1-[4-(2-methylpropyl)phenyl]ethanone. InChIKey: KEAGRYYGYWZVPC-UHFFFAOYSA-N.
| Molecular formula | C12H16O |
|---|---|
| Molecular weight | 176.25 g/mol |
| IUPAC name | 1-[4-(2-methylpropyl)phenyl]ethanone |
| InChIKey | KEAGRYYGYWZVPC-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=CC=C(C=C1)C(=O)C |
Computed by PubChem (NCBI)