Products 25926-14-1
CAS 25926-14-1 is the registry number for 4,4',4''-Nitrilotriphenol, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-(4-hydroxy-N-(4-hydroxyphenyl)anilino)phenol (CAS 25926-14-1) is a chemical compound with the molecular formula C18H15NO3 and a molecular weight of 293.3 g/mol. IUPAC name: 4-(4-hydroxy-N-(4-hydroxyphenyl)anilino)phenol. InChIKey: HUPXQMGQXGDRNA-UHFFFAOYSA-N.
| Molecular formula | C18H15NO3 |
|---|---|
| Molecular weight | 293.3 g/mol |
| IUPAC name | 4-(4-hydroxy-N-(4-hydroxyphenyl)anilino)phenol |
| InChIKey | HUPXQMGQXGDRNA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N(C2=CC=C(C=C2)O)C3=CC=C(C=C3)O)O |
Computed by PubChem (NCBI)