Products 107971-39-1
CAS 107971-39-1 is the registry number for Phenyl 4-oxo-2-phenyl-3,4-dihydropyridine-1(2h)-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
Phenyl 4-oxo-2-phenyl-2,3-dihydropyridine-1-carboxylate (CAS 107971-39-1) is a chemical compound with the molecular formula C18H15NO3 and a molecular weight of 293.3 g/mol. IUPAC name: phenyl 4-oxo-2-phenyl-2,3-dihydropyridine-1-carboxylate. InChIKey: DWAGSDOFLIDBFX-UHFFFAOYSA-N.
| Molecular formula | C18H15NO3 |
|---|---|
| Molecular weight | 293.3 g/mol |
| IUPAC name | phenyl 4-oxo-2-phenyl-2,3-dihydropyridine-1-carboxylate |
| InChIKey | DWAGSDOFLIDBFX-UHFFFAOYSA-N |
| SMILES | C1C(N(C=CC1=O)C(=O)OC2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)