Products 116734-22-6

CAS 116734-22-6 is the registry number for 2-(4-Methoxyphenyl)-6-methylquinoline-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(4-methoxyphenyl)-6-methylquinoline-4-carboxylic acid (CAS 116734-22-6) is a chemical compound with the molecular formula C18H15NO3 and a molecular weight of 293.3 g/mol. IUPAC name: 2-(4-methoxyphenyl)-6-methylquinoline-4-carboxylic acid. InChIKey: KFYRNTCJRHILBJ-UHFFFAOYSA-N.

Identity
Molecular formulaC18H15NO3
Molecular weight293.3 g/mol
IUPAC name2-(4-methoxyphenyl)-6-methylquinoline-4-carboxylic acid
InChIKeyKFYRNTCJRHILBJ-UHFFFAOYSA-N
SMILESCC1=CC2=C(C=C1)N=C(C=C2C(=O)O)C3=CC=C(C=C3)OC

Computed by PubChem (NCBI)