4,4',4''-Nitrilotriphenol, 97%
cas: 25926-14-1 — see every product listed under this CAS number, including other names
4,4',4''-Nitrilotriphenol, 97% (CAS 25926-14-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1904532-250mg |
| cas | 25926-14-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 765.31 Pln | |
| Ambeed | 1g | 1939.00 Pln | |
| Ambeed | 5g | 5671.44 Pln | |
| Chemat | 100mg | 395.60 Pln | |
| Chemat | 250mg | 563.60 Pln | |
| Chemat | 1g | 1418.00 Pln | |
| Chemat | 5g | 5704.40 Pln | |
| BLDpharm | 100mg | 564.27 Pln | |
| BLDpharm | 250mg | 819.74 Pln | |
| BLDpharm | 1g | 2085.96 Pln | |
| BLDpharm | 5g | 6112.32 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
4-(4-hydroxy-N-(4-hydroxyphenyl)anilino)phenol (CAS 25926-14-1) is a chemical compound with the molecular formula C18H15NO3 and a molecular weight of 293.3 g/mol. IUPAC name: 4-(4-hydroxy-N-(4-hydroxyphenyl)anilino)phenol. InChIKey: HUPXQMGQXGDRNA-UHFFFAOYSA-N.
| Molecular formula | C18H15NO3 |
|---|---|
| Molecular weight | 293.3 g/mol |
| IUPAC name | 4-(4-hydroxy-N-(4-hydroxyphenyl)anilino)phenol |
| InChIKey | HUPXQMGQXGDRNA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N(C2=CC=C(C=C2)O)C3=CC=C(C=C3)O)O |
Computed by PubChem (NCBI)