4,4'-(1,3-Phenylenebis(oxy))diphthalic acid, 98%
cas: 18959-91-6 — see every product listed under this CAS number, including other names
4,4'-(1,3-Phenylenebis(oxy))diphthalic acid, 98% (CAS 18959-91-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1156868-100mg |
| cas | 18959-91-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 337.00 Pln | |
| Ambeed | 250mg | 548.38 Pln | |
| Ambeed | 1g | 1499.56 Pln | |
| BLDpharm | 100mg | 353.23 Pln | |
| BLDpharm | 250mg | 580.93 Pln | |
| BLDpharm | 1g | 1608.35 Pln | |
| Chemat | 100mg | 232.40 Pln | |
| Chemat | 250mg | 405.20 Pln | |
| Chemat | 1g | 1082.00 Pln | |
| Fluorochem | 100mg | 336.36 Pln | |
| Fluorochem | 250mg | 555.03 Pln | |
| Fluorochem | 1g | 1549.47 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
4-[3-(3,4-dicarboxyphenoxy)phenoxy]phthalic acid (CAS 18959-91-6) is a chemical compound with the molecular formula C22H14O10 and a molecular weight of 438.3 g/mol. IUPAC name: 4-[3-(3,4-dicarboxyphenoxy)phenoxy]phthalic acid. InChIKey: GQUSLIBGUTZKJZ-UHFFFAOYSA-N.
| Molecular formula | C22H14O10 |
|---|---|
| Molecular weight | 438.3 g/mol |
| IUPAC name | 4-[3-(3,4-dicarboxyphenoxy)phenoxy]phthalic acid |
| InChIKey | GQUSLIBGUTZKJZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC2=CC(=C(C=C2)C(=O)O)C(=O)O)OC3=CC(=C(C=C3)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4,4'-(1,3-Phenylenebis(oxy))diphthalic acid, 4-[3-(3,4-dicarboxyphenoxy)phenoxy]phthalic acid, 4-[3-(3,4-dicarboxyphenoxy)phenoxy]benzene-1,2-dicarboxylic acid, 4,4'-[benzene-1,3-diylbis(oxy)]dibenzene-1,2-dicarboxylic acid, CBDivE_005251, Oprea1_373186, Oprea1_606359, 1,?2-?Benzenedicarboxylic acid, 4,?4'-?[1,?3-?phenylenebis(oxy)?]?bis-, 1,3-bis(3',4-dicarboxyphenoxy)benzene, 1,3-bis3',4'-bicarbonyloxylphenylbenzene