4,4'-(Pyrene-1,6-diyl)dibenzaldehyde, 97%
cas: 2243312-96-9 — see every product listed under this CAS number, including other names
4,4'-(Pyrene-1,6-diyl)dibenzaldehyde, 97% (CAS 2243312-96-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1351791-250mg |
| cas | 2243312-96-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 353.69 Pln | |
| Ambeed | 1g | 982.25 Pln | |
| BLDpharm | 100mg | 303.25 Pln | |
| BLDpharm | 250mg | 353.23 Pln | |
| BLDpharm | 1g | 1052.99 Pln | |
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 246.80 Pln | |
| Chemat | 1g | 794.00 Pln | |
| Fluorochem | 100mg | 294.71 Pln | |
| Fluorochem | 250mg | 336.36 Pln | |
| Fluorochem | 1g | 961.14 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
4-[6-(4-formylphenyl)pyren-1-yl]benzaldehyde (CAS 2243312-96-9) is a chemical compound with the molecular formula C30H18O2 and a molecular weight of 410.5 g/mol. IUPAC name: 4-[6-(4-formylphenyl)pyren-1-yl]benzaldehyde. InChIKey: BRCRRFATSAHBCW-UHFFFAOYSA-N.
| Molecular formula | C30H18O2 |
|---|---|
| Molecular weight | 410.5 g/mol |
| IUPAC name | 4-[6-(4-formylphenyl)pyren-1-yl]benzaldehyde |
| InChIKey | BRCRRFATSAHBCW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=CC3=C4C2=C1C=CC4=C(C=C3)C5=CC=C(C=C5)C=O)C6=CC=C(C=C6)C=O |
Computed by PubChem (NCBI)