cas: 39800-63-0 — see every product listed under this CAS number, including other names
4,4'-DIBUTOXYBIPHENYL, 98% (CAS 39800-63-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F842552-5G |
| cas | 39800-63-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 258.26 Pln | |
| Fluorochem | 25g | 518.59 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-butoxy-4-(4-butoxyphenyl)benzene (CAS 39800-63-0) is a chemical compound with the molecular formula C20H26O2 and a molecular weight of 298.4 g/mol. IUPAC name: 1-butoxy-4-(4-butoxyphenyl)benzene. InChIKey: IBCVAKLNEYUUBM-UHFFFAOYSA-N.
| Molecular formula | C20H26O2 |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | 1-butoxy-4-(4-butoxyphenyl)benzene |
| InChIKey | IBCVAKLNEYUUBM-UHFFFAOYSA-N |
| SMILES | CCCCOC1=CC=C(C=C1)C2=CC=C(C=C2)OCCCC |
Computed by PubChem (NCBI)