cas: 39800-63-0 — see every product listed under this CAS number, including other names
4,4'-Dibutoxy-1,1'-biphenyl, 98%, 98% (CAS 39800-63-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114KG8-1g |
| cas | 39800-63-0 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 146.00 Pln | |
| Chemat | 10g | 155.60 Pln | |
| Chemat | 25g | 170.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-butoxy-4-(4-butoxyphenyl)benzene (CAS 39800-63-0) is a chemical compound with the molecular formula C20H26O2 and a molecular weight of 298.4 g/mol. IUPAC name: 1-butoxy-4-(4-butoxyphenyl)benzene. InChIKey: IBCVAKLNEYUUBM-UHFFFAOYSA-N.
| Molecular formula | C20H26O2 |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | 1-butoxy-4-(4-butoxyphenyl)benzene |
| InChIKey | IBCVAKLNEYUUBM-UHFFFAOYSA-N |
| SMILES | CCCCOC1=CC=C(C=C1)C2=CC=C(C=C2)OCCCC |
Computed by PubChem (NCBI)