cas: 3988-03-2 — see every product listed under this CAS number, including other names
4,4'-Dibromobenzophenone 98% (CAS 3988-03-2) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A156486-1000g |
| cas | 3988-03-2 |
| size | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 4914.94 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 298.06 Pln | |
| Ambeed | 100g | 676.31 Pln | |
| Ambeed | 500g | 3096.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A156486 |
Bis(4-bromophenyl)methanone (CAS 3988-03-2) is a chemical compound with the molecular formula C13H8Br2O and a molecular weight of 340.01 g/mol. IUPAC name: bis(4-bromophenyl)methanone. InChIKey: LFABNOYDEODDFX-UHFFFAOYSA-N.
| Molecular formula | C13H8Br2O |
|---|---|
| Molecular weight | 340.01 g/mol |
| IUPAC name | bis(4-bromophenyl)methanone |
| InChIKey | LFABNOYDEODDFX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=CC=C(C=C2)Br)Br |
Computed by PubChem (NCBI)