4,4-Dibromobenzophenone, 98%, 98%
cas: 3988-03-2 — see every product listed under this CAS number, including other names
4,4-Dibromobenzophenone, 98%, 98% (CAS 3988-03-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 75g, 100g, 200g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1144UN-1g |
| cas | 3988-03-2 |
| size | 1g |
| availability | 10000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 102.80 Pln | |
| Chemat | 10g | 141.20 Pln | |
| Chemat | 25g | 261.20 Pln | |
| Chemat | 75g | 674.00 Pln | |
| Chemat | 100g | 851.60 Pln | |
| Chemat | 200g | 1571.60 Pln | |
| Chemat | 1kg | 4235.60 Pln | |
| Chemat | 5kg | 8587.20 Pln | |
| Chemat | 10kg | price on request |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Bis(4-bromophenyl)methanone (CAS 3988-03-2) is a chemical compound with the molecular formula C13H8Br2O and a molecular weight of 340.01 g/mol. IUPAC name: bis(4-bromophenyl)methanone. InChIKey: LFABNOYDEODDFX-UHFFFAOYSA-N.
| Molecular formula | C13H8Br2O |
|---|---|
| Molecular weight | 340.01 g/mol |
| IUPAC name | bis(4-bromophenyl)methanone |
| InChIKey | LFABNOYDEODDFX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=CC=C(C=C2)Br)Br |
Computed by PubChem (NCBI)