cas: 204315-81-1 — see every product listed under this CAS number, including other names
4,4'-Diiodo[1,1'-biphenyl]-2,2'-diol, 95%, 95% (CAS 204315-81-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FVJS-100mg |
| cas | 204315-81-1 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 309.20 Pln | |
| Chemat | 250mg | 477.20 Pln | |
| Chemat | 1g | 750.80 Pln | |
| Chemat | 5g | 2128.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(2-hydroxy-4-iodophenyl)-5-iodophenol (CAS 204315-81-1) is a chemical compound with the molecular formula C12H8I2O2 and a molecular weight of 438.00 g/mol. IUPAC name: 2-(2-hydroxy-4-iodophenyl)-5-iodophenol. InChIKey: QLPSDVPSDROOIG-UHFFFAOYSA-N.
| Molecular formula | C12H8I2O2 |
|---|---|
| Molecular weight | 438.00 g/mol |
| IUPAC name | 2-(2-hydroxy-4-iodophenyl)-5-iodophenol |
| InChIKey | QLPSDVPSDROOIG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1I)O)C2=C(C=C(C=C2)I)O |
Computed by PubChem (NCBI)