cas: 204315-81-1 — see every product listed under this CAS number, including other names
5,5'-Diiodo-[1,1'-biphenyl]-2,2'-diol 95% (CAS 204315-81-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1204915-100mg |
| cas | 204315-81-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 542.81 Pln | |
| Ambeed | 250mg | 854.31 Pln | |
| Ambeed | 1g | 1010.06 Pln | |
| Ambeed | 5g | 4052.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1204915 |
2-(2-hydroxy-4-iodophenyl)-5-iodophenol (CAS 204315-81-1) is a chemical compound with the molecular formula C12H8I2O2 and a molecular weight of 438.00 g/mol. IUPAC name: 2-(2-hydroxy-4-iodophenyl)-5-iodophenol. InChIKey: QLPSDVPSDROOIG-UHFFFAOYSA-N.
| Molecular formula | C12H8I2O2 |
|---|---|
| Molecular weight | 438.00 g/mol |
| IUPAC name | 2-(2-hydroxy-4-iodophenyl)-5-iodophenol |
| InChIKey | QLPSDVPSDROOIG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1I)O)C2=C(C=C(C=C2)I)O |
Computed by PubChem (NCBI)