cas: 90-96-0 — see every product listed under this CAS number, including other names
4,4'-Dimethoxybenzophenone, 98% (CAS 90-96-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 5g, 25g, 50g, 100g, 250g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F201577-10G |
| cas | 90-96-0 |
| size | 10g |
| availability | In Stock Germany |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 102.07 Pln | |
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 25g | 117.68 Pln | |
| Fluorochem | 50g | 164.54 Pln | |
| Fluorochem | 100g | 211.40 Pln | |
| Fluorochem | 250g | 398.84 Pln | |
| Fluorochem | 500g | 695.61 Pln | |
| Fluorochem | 1kg | 1101.71 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
Bis(4-methoxyphenyl)methanone (CAS 90-96-0) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: bis(4-methoxyphenyl)methanone. InChIKey: RFVHVYKVRGKLNK-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | bis(4-methoxyphenyl)methanone |
| InChIKey | RFVHVYKVRGKLNK-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)