4,4’-Dimethoxybenzophenone, 98%, 98%
cas: 90-96-0 — see every product listed under this CAS number, including other names
4,4’-Dimethoxybenzophenone, 98%, 98% (CAS 90-96-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 250g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1144UX-5g |
| cas | 90-96-0 |
| size | 5g |
| availability | 25000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 88.40 Pln | |
| Chemat | 50g | 107.60 Pln | |
| Chemat | 100g | 146.00 Pln | |
| Chemat | 250g | 266.00 Pln | |
| Chemat | 500g | 528.00 Pln | |
| Chemat | 1kg | 938.00 Pln | |
| Chemat | 5kg | 3235.20 Pln | |
| Chemat | 25kg | price on request |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Bis(4-methoxyphenyl)methanone (CAS 90-96-0) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: bis(4-methoxyphenyl)methanone. InChIKey: RFVHVYKVRGKLNK-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | bis(4-methoxyphenyl)methanone |
| InChIKey | RFVHVYKVRGKLNK-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)